C28H46N2O8 — CID 155162343
[(E,3R,4R,5R,6R,9S,10S,12S)-9-amino-1-[formyl(methyl)amino]-4-hydroxy-10-methoxy-3,5,13-trimethyl-12-propanoyloxytetradec-1-en-6-yl] furan-2-carboxylate (PubChem CID 155162343) has the molecular formula C28H46N2O8 and a molecular weight of 538.68 g/mol. Its IUPAC name is [(E,3R,4R,5R,6R,9S,10S,12S)-9-amino-1-[formyl(methyl)amino]-4-hydroxy-10-methoxy-3,5,13-trimethyl-12-propanoyloxytetradec-1-en-6-yl] furan-2-carboxylate.
| Compound Name | [(E,3R,4R,5R,6R,9S,10S,12S)-9-amino-1-[formyl(methyl)amino]-4-hydroxy-10-methoxy-3,5,13-trimethyl-12-propanoyloxytetradec-1-en-6-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 155162343 |
| Molecular Formula | C28H46N2O8 |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | [(E,3R,4R,5R,6R,9S,10S,12S)-9-amino-1-[formyl(methyl)amino]-4-hydroxy-10-methoxy-3,5,13-trimethyl-12-propanoyloxytetradec-1-en-6-yl] furan-2-carboxylate |
| SMILES | CCC(=O)O[C@@H](C[C@H](OC)[C@@H](N)CC[C@@H](OC(=O)c1ccco1)[C@H](C)[C@H](O)[C@H](C)/C=C/N(C)C=O)C(C)C |
| InChI | InChI=1S/C28H46N2O8/c1-8-26(32)37-24(18(2)3)16-25(35-7)21(29)11-12-22(38-28(34)23-10-9-15-36-23)20(5)27(33)19(4)13-14-30(6)17-31/h9-10,13-15,17-22,24-25,27,33H,8,11-12,16,29H2,1-7H3/b14-13+/t19-,20+,21+,22-,24+,25+,27-/m1/s1 |
| InChIKey | QPBGJCRDXONQDT-KBKOCYDGSA-N |
| XLogP | 3.53 |
| TPSA | 141.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|