C16H29N3O3 — CID 155163387
5-imino-16,16-dimethyl-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclohexadecane-2,7-dione (PubChem CID 155163387) has the molecular formula C16H29N3O3 and a molecular weight of 314.44 g/mol. Its IUPAC name is 5-imino-16,16-dimethyl-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclohexadecane-2,7-dione.
| Compound Name | 5-imino-16,16-dimethyl-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclohexadecane-2,7-dione |
|---|---|
| PubChem CID | 155163387 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | 5-imino-16,16-dimethyl-4-(trideuteriomethyl)-1-oxa-4,6-diazacyclohexadecane-2,7-dione |
| SMILES | [H]/N=C1/NC(=O)CCCCCCCCC(C)(C)OC(=O)CN1C([2H])([2H])[2H] |
| InChI | InChI=1S/C16H29N3O3/c1-16(2)11-9-7-5-4-6-8-10-13(20)18-15(17)19(3)12-14(21)22-16/h4-12H2,1-3H3,(H2,17,18,20)/i3D3 |
| InChIKey | JMHRVXZAWJOXKT-HPRDVNIFSA-N |
| XLogP | 2.43 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|