C17H24N4OS — CID 155164758
3-(cyanoamino)-N-[2-[(1R)-2,2-dimethylcyclohexyl]-1,3-thiazol-5-yl]cyclobutane-1-carboxamide (PubChem CID 155164758) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is 3-(cyanoamino)-N-[2-[(1R)-2,2-dimethylcyclohexyl]-1,3-thiazol-5-yl]cyclobutane-1-carboxamide.
| Compound Name | 3-(cyanoamino)-N-[2-[(1R)-2,2-dimethylcyclohexyl]-1,3-thiazol-5-yl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 155164758 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 3-(cyanoamino)-N-[2-[(1R)-2,2-dimethylcyclohexyl]-1,3-thiazol-5-yl]cyclobutane-1-carboxamide |
| SMILES | CC1(C)CCCC[C@H]1c1ncc(NC(=O)C2CC(NC#N)C2)s1 |
| InChI | InChI=1S/C17H24N4OS/c1-17(2)6-4-3-5-13(17)16-19-9-14(23-16)21-15(22)11-7-12(8-11)20-10-18/h9,11-13,20H,3-8H2,1-2H3,(H,21,22)/t11?,12?,13-/m0/s1 |
| InChIKey | HLKNBVWPPLURCV-BPCQOVAHSA-N |
| XLogP | 3.61 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|