C22H21ClF2N6O2 — CID 155164903
(1S,2S,3R,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-fluorocyclopentane-1,2-diol (PubChem CID 155164903) has the molecular formula C22H21ClF2N6O2 and a molecular weight of 474.90 g/mol. Its IUPAC name is (1S,2S,3R,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-fluorocyclopentane-1,2-diol.
| Compound Name | (1S,2S,3R,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-fluorocyclopentane-1,2-diol |
|---|---|
| PubChem CID | 155164903 |
| Molecular Formula | C22H21ClF2N6O2 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | (1S,2S,3R,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-fluorocyclopentane-1,2-diol |
| SMILES | Nc1nc2cc(CC[C@@]3(F)C[C@@H](n4ccc5c(N)ncnc54)[C@H](O)[C@@H]3O)cc(F)c2cc1Cl |
| InChI | InChI=1S/C22H21ClF2N6O2/c23-13-7-12-14(24)5-10(6-15(12)30-20(13)27)1-3-22(25)8-16(17(32)18(22)33)31-4-2-11-19(26)28-9-29-21(11)31/h2,4-7,9,16-18,32-33H,1,3,8H2,(H2,27,30)(H2,26,28,29)/t16-,17+,18+,22-/m1/s1 |
| InChIKey | ORFCEJDKJZUQRB-BZDHPDOMSA-N |
| XLogP | 2.94 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |