C23H24ClFN6O3 — CID 155164908
(1S,2R,3S,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 155164908) has the molecular formula C23H24ClFN6O3 and a molecular weight of 486.94 g/mol. Its IUPAC name is (1S,2R,3S,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 155164908 |
| Molecular Formula | C23H24ClFN6O3 |
| Molecular Weight | 486.94 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | (1S,2R,3S,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Nc1nc2cc(CC[C@@]3(CO)C[C@@H](n4ccc5c(N)ncnc54)[C@H](O)[C@@H]3O)cc(F)c2cc1Cl |
| InChI | InChI=1S/C23H24ClFN6O3/c24-14-7-13-15(25)5-11(6-16(13)30-21(14)27)1-3-23(9-32)8-17(18(33)19(23)34)31-4-2-12-20(26)28-10-29-22(12)31/h2,4-7,10,17-19,32-34H,1,3,8-9H2,(H2,27,30)(H2,26,28,29)/t17-,18+,19+,23+/m1/s1 |
| InChIKey | HMLIRPVBBCJVHS-XQQXVUDOSA-N |
| XLogP | 2.21 |
| TPSA | 156.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.94 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |