C23H24ClFN6O2 — CID 155165021
(1S,2R,3S,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-methylcyclopentane-1,2-diol (PubChem CID 155165021) has the molecular formula C23H24ClFN6O2 and a molecular weight of 470.94 g/mol. Its IUPAC name is (1S,2R,3S,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-methylcyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-methylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 155165021 |
| Molecular Formula | C23H24ClFN6O2 |
| Molecular Weight | 470.94 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | (1S,2R,3S,5R)-3-[2-(2-amino-3-chloro-5-fluoroquinolin-7-yl)ethyl]-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3-methylcyclopentane-1,2-diol |
| SMILES | C[C@]1(CCc2cc(F)c3cc(Cl)c(N)nc3c2)C[C@@H](n2ccc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H24ClFN6O2/c1-23(4-2-11-6-15(25)13-8-14(24)21(27)30-16(13)7-11)9-17(18(32)19(23)33)31-5-3-12-20(26)28-10-29-22(12)31/h3,5-8,10,17-19,32-33H,2,4,9H2,1H3,(H2,27,30)(H2,26,28,29)/t17-,18+,19+,23+/m1/s1 |
| InChIKey | QPSVMQHJKGQZAL-XQQXVUDOSA-N |
| XLogP | 3.24 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.94 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |