C20H21Cl2F3N4O — CID 155165187
6-[(3aS,6aR)-3a-(aminomethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(2,3-dichlorophenyl)-2-methyl-5-(trifluoromethyl)pyrimidin-4-one (PubChem CID 155165187) has the molecular formula C20H21Cl2F3N4O and a molecular weight of 461.32 g/mol. Its IUPAC name is 6-[(3aS,6aR)-3a-(aminomethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(2,3-dichlorophenyl)-2-methyl-5-(trifluoromethyl)pyrimidin-4-one.
| Compound Name | 6-[(3aS,6aR)-3a-(aminomethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(2,3-dichlorophenyl)-2-methyl-5-(trifluoromethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 155165187 |
| Molecular Formula | C20H21Cl2F3N4O |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 6-[(3aS,6aR)-3a-(aminomethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(2,3-dichlorophenyl)-2-methyl-5-(trifluoromethyl)pyrimidin-4-one |
| SMILES | Cc1nc(N2C[C@@H]3CCC[C@]3(CN)C2)c(C(F)(F)F)c(=O)n1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C20H21Cl2F3N4O/c1-11-27-17(28-8-12-4-3-7-19(12,9-26)10-28)15(20(23,24)25)18(30)29(11)14-6-2-5-13(21)16(14)22/h2,5-6,12H,3-4,7-10,26H2,1H3/t12-,19-/m0/s1 |
| InChIKey | YVVUOLALXRPCFN-BUXKBTBVSA-N |
| XLogP | 4.43 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |