About 1-amino-6-(6-azaspiro[2.5]octan-6-yl)-3-(2,3-dichlorophenyl)-2,5-dimethyl-2H-pyrimidin-4-one
1-amino-6-(6-azaspiro[2.5]octan-6-yl)-3-(2,3-dichlorophenyl)-2,5-dimethyl-2H-pyrimidin-4-one (PubChem CID 155165299) has the molecular formula C19H24Cl2N4O
and a molecular weight of 395.33 g/mol. Its IUPAC name is 1-amino-6-(6-azaspiro[2.5]octan-6-yl)-3-(2,3-dichlorophenyl)-2,5-dimethyl-2H-pyrimidin-4-one.
Molecular Properties
| Compound Name | 1-amino-6-(6-azaspiro[2.5]octan-6-yl)-3-(2,3-dichlorophenyl)-2,5-dimethyl-2H-pyrimidin-4-one |
| PubChem CID | 155165299 |
| Molecular Formula | C19H24Cl2N4O |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 1-amino-6-(6-azaspiro[2.5]octan-6-yl)-3-(2,3-dichlorophenyl)-2,5-dimethyl-2H-pyrimidin-4-one |
| SMILES | CC1=C(N2CCC3(CC2)CC3)N(N)C(C)N(c2cccc(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C19H24Cl2N4O/c1-12-17(23-10-8-19(6-7-19)9-11-23)25(22)13(2)24(18(12)26)15-5-3-4-14(20)16(15)21/h3-5,13H,6-11,22H2,1-2H3 |
| InChIKey | DHUREEITVUQPGS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-6-(6-azaspiro[2.5]octan-6-yl)-3-(2,3-dichlorophenyl)-2,5-dimethyl-2H-pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-6-(6-azaspiro[2.5]octan-6-yl)-3-(2,3-dichlorophenyl)-2,5-dimethyl-2H-pyrimidin-4-one?
The IUPAC name of 1-amino-6-(6-azaspiro[2.5]octan-6-yl)-3-(2,3-dichlorophenyl)-2,5-dimethyl-2H-pyrimidin-4-one (CID 155165299) is 1-amino-6-(6-azaspiro[2.5]octan-6-yl)-3-(2,3-dichlorophenyl)-2,5-dimethyl-2H-pyrimidin-4-one.
What is the SMILES notation for 1-amino-6-(6-azaspiro[2.5]octan-6-yl)-3-(2,3-dichlorophenyl)-2,5-dimethyl-2H-pyrimidin-4-one?
The canonical SMILES for 1-amino-6-(6-azaspiro[2.5]octan-6-yl)-3-(2,3-dichlorophenyl)-2,5-dimethyl-2H-pyrimidin-4-one is CC1=C(N2CCC3(CC2)CC3)N(N)C(C)N(c2cccc(Cl)c2Cl)C1=O.
What is the InChIKey of 1-amino-6-(6-azaspiro[2.5]octan-6-yl)-3-(2,3-dichlorophenyl)-2,5-dimethyl-2H-pyrimidin-4-one?
The InChIKey is DHUREEITVUQPGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24Cl2N4O/c1-12-17(23-10-8-19(6-7-19)9-11-23)25(22)13(2)24(18(12)26)15-5-3-4-14(20)16(15)21/h3-5,13H,6-11,22H2,1-2H3.
What are the key properties of 1-amino-6-(6-azaspiro[2.5]octan-6-yl)-3-(2,3-dichlorophenyl)-2,5-dimethyl-2H-pyrimidin-4-one?
1-amino-6-(6-azaspiro[2.5]octan-6-yl)-3-(2,3-dichlorophenyl)-2,5-dimethyl-2H-pyrimidin-4-one has a molecular weight of 395.33 g/mol, XLogP of 3.97, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-6-(6-azaspiro[2.5]octan-6-yl)-3-(2,3-dichlorophenyl)-2,5-dimethyl-2H-pyrimidin-4-one is sourced from PubChem (CID 155165299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).