C43H40F6O3S3 — CID 155166202
3-[2-[2,5-bis(5-tert-butylthiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-(4-tert-butylphenyl)-1-benzofuran-5,6-diol (PubChem CID 155166202) has the molecular formula C43H40F6O3S3 and a molecular weight of 814.98 g/mol. Its IUPAC name is 3-[2-[2,5-bis(5-tert-butylthiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-(4-tert-butylphenyl)-1-benzofuran-5,6-diol.
| Compound Name | 3-[2-[2,5-bis(5-tert-butylthiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-(4-tert-butylphenyl)-1-benzofuran-5,6-diol |
|---|---|
| PubChem CID | 155166202 |
| Molecular Formula | C43H40F6O3S3 |
| Molecular Weight | 814.98 g/mol |
| Exact Mass | 814.20 |
| IUPAC Name | 3-[2-[2,5-bis(5-tert-butylthiophen-2-yl)thiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-(4-tert-butylphenyl)-1-benzofuran-5,6-diol |
| SMILES | CC(C)(C)c1ccc(-c2oc3cc(O)c(O)cc3c2C2=C(c3cc(-c4ccc(C(C)(C)C)s4)sc3-c3ccc(C(C)(C)C)s3)C(F)(F)C(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C43H40F6O3S3/c1-38(2,3)22-12-10-21(11-13-22)36-33(23-18-25(50)26(51)20-27(23)52-36)35-34(41(44,45)43(48,49)42(35,46)47)24-19-30(28-14-16-31(53-28)39(4,5)6)55-37(24)29-15-17-32(54-29)40(7,8)9/h10-20,50-51H,1-9H3 |
| InChIKey | WWNJKHIWNPGQNB-UHFFFAOYSA-N |
| XLogP | 14.75 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.98 |
| LogP ≤ 5 | 14.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|