C10H14N2S — CID 155166507
3,5,5a,6,7,8-hexahydro-2H-[1,3]thiazolo[2,3-b]quinazoline (PubChem CID 155166507) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is 3,5,5a,6,7,8-hexahydro-2H-[1,3]thiazolo[2,3-b]quinazoline.
| Compound Name | 3,5,5a,6,7,8-hexahydro-2H-[1,3]thiazolo[2,3-b]quinazoline |
|---|---|
| PubChem CID | 155166507 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3,5,5a,6,7,8-hexahydro-2H-[1,3]thiazolo[2,3-b]quinazoline |
| SMILES | C1=C2N=C3SCCN3CC2CCC1 |
| InChI | InChI=1S/C10H14N2S/c1-2-4-9-8(3-1)7-12-5-6-13-10(12)11-9/h4,8H,1-3,5-7H2 |
| InChIKey | JCMDGYIZKCVYLW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |