C13H18N4S2 — CID 155166510
(4aR,8aR)-1-(4,5-dihydro-1H-imidazol-2-ylsulfanylmethyl)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole (PubChem CID 155166510) has the molecular formula C13H18N4S2 and a molecular weight of 294.45 g/mol. Its IUPAC name is (4aR,8aR)-1-(4,5-dihydro-1H-imidazol-2-ylsulfanylmethyl)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole.
| Compound Name | (4aR,8aR)-1-(4,5-dihydro-1H-imidazol-2-ylsulfanylmethyl)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole |
|---|---|
| PubChem CID | 155166510 |
| Molecular Formula | C13H18N4S2 |
| Molecular Weight | 294.45 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (4aR,8aR)-1-(4,5-dihydro-1H-imidazol-2-ylsulfanylmethyl)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole |
| SMILES | C1=C(CSC2=NCCN2)N2C(=N[C@@H]3CCCC[C@H]32)S1 |
| InChI | InChI=1S/C13H18N4S2/c1-2-4-11-10(3-1)16-13-17(11)9(8-19-13)7-18-12-14-5-6-15-12/h8,10-11H,1-7H2,(H,14,15)/t10-,11-/m1/s1 |
| InChIKey | FADCOHRPNXBENV-GHMZBOCLSA-N |
| XLogP | 2.25 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |