C11H18N4S — CID 155166541
2-(3-imidazol-1-ylpropylsulfanyl)-5,5-dimethyl-1,4-dihydroimidazole (PubChem CID 155166541) has the molecular formula C11H18N4S and a molecular weight of 238.36 g/mol. Its IUPAC name is 2-(3-imidazol-1-ylpropylsulfanyl)-5,5-dimethyl-1,4-dihydroimidazole.
| Compound Name | 2-(3-imidazol-1-ylpropylsulfanyl)-5,5-dimethyl-1,4-dihydroimidazole |
|---|---|
| PubChem CID | 155166541 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2-(3-imidazol-1-ylpropylsulfanyl)-5,5-dimethyl-1,4-dihydroimidazole |
| SMILES | CC1(C)CN=C(SCCCn2ccnc2)N1 |
| InChI | InChI=1S/C11H18N4S/c1-11(2)8-13-10(14-11)16-7-3-5-15-6-4-12-9-15/h4,6,9H,3,5,7-8H2,1-2H3,(H,13,14) |
| InChIKey | CWXZBMCXAHTWJW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|