C15H24Cl2N4S2 — CID 155166648
3-[[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]-6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole;dihydrochloride (PubChem CID 155166648) has the molecular formula C15H24Cl2N4S2 and a molecular weight of 395.43 g/mol. Its IUPAC name is 3-[[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]-6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole;dihydrochloride.
| Compound Name | 3-[[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]-6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole;dihydrochloride |
|---|---|
| PubChem CID | 155166648 |
| Molecular Formula | C15H24Cl2N4S2 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 3-[[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]-6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole;dihydrochloride |
| SMILES | CC1(C)CN2C(CSC3=N[C@@H]4CCCC[C@H]4N3)=CSC2=N1.Cl.Cl |
| InChI | InChI=1S/C15H22N4S2.2ClH/c1-15(2)9-19-10(8-21-14(19)18-15)7-20-13-16-11-5-3-4-6-12(11)17-13;;/h8,11-12H,3-7,9H2,1-2H3,(H,16,17);2*1H/t11-,12-;;/m1../s1 |
| InChIKey | AUSRSSDRDIQTSI-MBORUXJMSA-N |
| XLogP | 3.87 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |