C15H24N4S2 — CID 155166707
3-[(5,5-dimethyl-1,4-dihydroimidazol-2-yl)sulfanylmethyl]-5,5,6,6-tetramethylimidazo[2,1-b][1,3]thiazole (PubChem CID 155166707) has the molecular formula C15H24N4S2 and a molecular weight of 324.52 g/mol. Its IUPAC name is 3-[(5,5-dimethyl-1,4-dihydroimidazol-2-yl)sulfanylmethyl]-5,5,6,6-tetramethylimidazo[2,1-b][1,3]thiazole.
| Compound Name | 3-[(5,5-dimethyl-1,4-dihydroimidazol-2-yl)sulfanylmethyl]-5,5,6,6-tetramethylimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 155166707 |
| Molecular Formula | C15H24N4S2 |
| Molecular Weight | 324.52 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 3-[(5,5-dimethyl-1,4-dihydroimidazol-2-yl)sulfanylmethyl]-5,5,6,6-tetramethylimidazo[2,1-b][1,3]thiazole |
| SMILES | CC1(C)CN=C(SCC2=CSC3=NC(C)(C)C(C)(C)N23)N1 |
| InChI | InChI=1S/C15H24N4S2/c1-13(2)9-16-11(17-13)20-7-10-8-21-12-18-14(3,4)15(5,6)19(10)12/h8H,7,9H2,1-6H3,(H,16,17) |
| InChIKey | GBEHFEBGJWAJAB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |