C16H26Cl2N4S2 — CID 155166734
3-(1,4,4a,5,6,7,8,8a-octahydroquinazolin-2-ylsulfanylmethyl)-6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole;dihydrochloride (PubChem CID 155166734) has the molecular formula C16H26Cl2N4S2 and a molecular weight of 409.45 g/mol. Its IUPAC name is 3-(1,4,4a,5,6,7,8,8a-octahydroquinazolin-2-ylsulfanylmethyl)-6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole;dihydrochloride.
| Compound Name | 3-(1,4,4a,5,6,7,8,8a-octahydroquinazolin-2-ylsulfanylmethyl)-6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole;dihydrochloride |
|---|---|
| PubChem CID | 155166734 |
| Molecular Formula | C16H26Cl2N4S2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 3-(1,4,4a,5,6,7,8,8a-octahydroquinazolin-2-ylsulfanylmethyl)-6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazole;dihydrochloride |
| SMILES | CC1(C)CN2C(CSC3=NCC4CCCCC4N3)=CSC2=N1.Cl.Cl |
| InChI | InChI=1S/C16H24N4S2.2ClH/c1-16(2)10-20-12(9-22-15(20)19-16)8-21-14-17-7-11-5-3-4-6-13(11)18-14;;/h9,11,13H,3-8,10H2,1-2H3,(H,17,18);2*1H |
| InChIKey | ACXWUDBSBVSKBC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |