C9H13ClN2S — CID 155166861
3-(chloromethyl)-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[3,2-a]pyrimidine (PubChem CID 155166861) has the molecular formula C9H13ClN2S and a molecular weight of 216.74 g/mol. Its IUPAC name is 3-(chloromethyl)-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[3,2-a]pyrimidine.
| Compound Name | 3-(chloromethyl)-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[3,2-a]pyrimidine |
|---|---|
| PubChem CID | 155166861 |
| Molecular Formula | C9H13ClN2S |
| Molecular Weight | 216.74 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 3-(chloromethyl)-6,6-dimethyl-5,7-dihydro-[1,3]thiazolo[3,2-a]pyrimidine |
| SMILES | CC1(C)CN=C2SC=C(CCl)N2C1 |
| InChI | InChI=1S/C9H13ClN2S/c1-9(2)5-11-8-12(6-9)7(3-10)4-13-8/h4H,3,5-6H2,1-2H3 |
| InChIKey | ZGAMQNLUGKYFGK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.74 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|