C13H18N4OS2 — CID 155166902
2-[(6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-3-yl)methylsulfanyl]-3a,4,6,6a-tetrahydro-1H-furo[3,4-d]imidazole (PubChem CID 155166902) has the molecular formula C13H18N4OS2 and a molecular weight of 310.45 g/mol. Its IUPAC name is 2-[(6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-3-yl)methylsulfanyl]-3a,4,6,6a-tetrahydro-1H-furo[3,4-d]imidazole.
| Compound Name | 2-[(6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-3-yl)methylsulfanyl]-3a,4,6,6a-tetrahydro-1H-furo[3,4-d]imidazole |
|---|---|
| PubChem CID | 155166902 |
| Molecular Formula | C13H18N4OS2 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-[(6,6-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-3-yl)methylsulfanyl]-3a,4,6,6a-tetrahydro-1H-furo[3,4-d]imidazole |
| SMILES | CC1(C)CN2C(CSC3=NC4COCC4N3)=CSC2=N1 |
| InChI | InChI=1S/C13H18N4OS2/c1-13(2)7-17-8(6-20-12(17)16-13)5-19-11-14-9-3-18-4-10(9)15-11/h6,9-10H,3-5,7H2,1-2H3,(H,14,15) |
| InChIKey | YNVRYVOJEDSGNN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |