About 1-[4-[2-(1,3-dioxolan-2-yl)propyl]cyclohex-3-en-1-yl]-2-methylpropan-2-ol
1-[4-[2-(1,3-dioxolan-2-yl)propyl]cyclohex-3-en-1-yl]-2-methylpropan-2-ol (PubChem CID 155166911) has the molecular formula C16H28O3
and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-[4-[2-(1,3-dioxolan-2-yl)propyl]cyclohex-3-en-1-yl]-2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 1-[4-[2-(1,3-dioxolan-2-yl)propyl]cyclohex-3-en-1-yl]-2-methylpropan-2-ol |
| PubChem CID | 155166911 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 1-[4-[2-(1,3-dioxolan-2-yl)propyl]cyclohex-3-en-1-yl]-2-methylpropan-2-ol |
| SMILES | CC(CC1=CCC(CC(C)(C)O)CC1)C1OCCO1 |
| InChI | InChI=1S/C16H28O3/c1-12(15-18-8-9-19-15)10-13-4-6-14(7-5-13)11-16(2,3)17/h4,12,14-15,17H,5-11H2,1-3H3 |
| InChIKey | ORXFVWNCKUURML-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[2-(1,3-dioxolan-2-yl)propyl]cyclohex-3-en-1-yl]-2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[2-(1,3-dioxolan-2-yl)propyl]cyclohex-3-en-1-yl]-2-methylpropan-2-ol?
The IUPAC name of 1-[4-[2-(1,3-dioxolan-2-yl)propyl]cyclohex-3-en-1-yl]-2-methylpropan-2-ol (CID 155166911) is 1-[4-[2-(1,3-dioxolan-2-yl)propyl]cyclohex-3-en-1-yl]-2-methylpropan-2-ol.
What is the SMILES notation for 1-[4-[2-(1,3-dioxolan-2-yl)propyl]cyclohex-3-en-1-yl]-2-methylpropan-2-ol?
The canonical SMILES for 1-[4-[2-(1,3-dioxolan-2-yl)propyl]cyclohex-3-en-1-yl]-2-methylpropan-2-ol is CC(CC1=CCC(CC(C)(C)O)CC1)C1OCCO1.
What is the InChIKey of 1-[4-[2-(1,3-dioxolan-2-yl)propyl]cyclohex-3-en-1-yl]-2-methylpropan-2-ol?
The InChIKey is ORXFVWNCKUURML-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O3/c1-12(15-18-8-9-19-15)10-13-4-6-14(7-5-13)11-16(2,3)17/h4,12,14-15,17H,5-11H2,1-3H3.
What are the key properties of 1-[4-[2-(1,3-dioxolan-2-yl)propyl]cyclohex-3-en-1-yl]-2-methylpropan-2-ol?
1-[4-[2-(1,3-dioxolan-2-yl)propyl]cyclohex-3-en-1-yl]-2-methylpropan-2-ol has a molecular weight of 268.40 g/mol, XLogP of 3.27, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[2-(1,3-dioxolan-2-yl)propyl]cyclohex-3-en-1-yl]-2-methylpropan-2-ol is sourced from PubChem (CID 155166911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).