C20H34O6 — CID 155167165
[(2E)-3,7-dimethylocta-2,6-dienyl] acetate;ethyl 2-(2-methyl-1,3-dioxolan-2-yl)acetate (PubChem CID 155167165) has the molecular formula C20H34O6 and a molecular weight of 370.49 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] acetate;ethyl 2-(2-methyl-1,3-dioxolan-2-yl)acetate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] acetate;ethyl 2-(2-methyl-1,3-dioxolan-2-yl)acetate |
|---|---|
| PubChem CID | 155167165 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] acetate;ethyl 2-(2-methyl-1,3-dioxolan-2-yl)acetate |
| SMILES | CC(=O)OC/C=C(\C)CCC=C(C)C.CCOC(=O)CC1(C)OCCO1 |
| InChI | InChI=1S/C12H20O2.C8H14O4/c1-10(2)6-5-7-11(3)8-9-14-12(4)13;1-3-10-7(9)6-8(2)11-4-5-12-8/h6,8H,5,7,9H2,1-4H3;3-6H2,1-2H3/b11-8+; |
| InChIKey | QSRAVECASXSWIL-YGCVIUNWSA-N |
| XLogP | 3.94 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|