About 4-(2,3-dimethylimidazol-3-ium-1-yl)-2,2-diphenylbutanamide iodide
4-(2,3-dimethylimidazol-3-ium-1-yl)-2,2-diphenylbutanamide iodide (PubChem CID 15516742) has the molecular formula C21H24IN3O
and a molecular weight of 461.35 g/mol. Its IUPAC name is 4-(2,3-dimethylimidazol-3-ium-1-yl)-2,2-diphenylbutanamide iodide.
Molecular Properties
| Compound Name | 4-(2,3-dimethylimidazol-3-ium-1-yl)-2,2-diphenylbutanamide iodide |
| PubChem CID | 15516742 |
| Molecular Formula | C21H24IN3O |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 4-(2,3-dimethylimidazol-3-ium-1-yl)-2,2-diphenylbutanamide iodide |
| SMILES | Cc1n(CCC(C(N)=O)(c2ccccc2)c2ccccc2)cc[n+]1C.[I-] |
| InChI | InChI=1S/C21H23N3O.HI/c1-17-23(2)15-16-24(17)14-13-21(20(22)25,18-9-5-3-6-10-18)19-11-7-4-8-12-19;/h3-12,15-16H,13-14H2,1-2H3,(H-,22,25);1H |
| InChIKey | UXYGPHWBDOVVQM-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 51.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3-dimethylimidazol-3-ium-1-yl)-2,2-diphenylbutanamide iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dimethylimidazol-3-ium-1-yl)-2,2-diphenylbutanamide iodide?
The IUPAC name of 4-(2,3-dimethylimidazol-3-ium-1-yl)-2,2-diphenylbutanamide iodide (CID 15516742) is 4-(2,3-dimethylimidazol-3-ium-1-yl)-2,2-diphenylbutanamide iodide.
What is the SMILES notation for 4-(2,3-dimethylimidazol-3-ium-1-yl)-2,2-diphenylbutanamide iodide?
The canonical SMILES for 4-(2,3-dimethylimidazol-3-ium-1-yl)-2,2-diphenylbutanamide iodide is Cc1n(CCC(C(N)=O)(c2ccccc2)c2ccccc2)cc[n+]1C.[I-].
What is the InChIKey of 4-(2,3-dimethylimidazol-3-ium-1-yl)-2,2-diphenylbutanamide iodide?
The InChIKey is UXYGPHWBDOVVQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O.HI/c1-17-23(2)15-16-24(17)14-13-21(20(22)25,18-9-5-3-6-10-18)19-11-7-4-8-12-19;/h3-12,15-16H,13-14H2,1-2H3,(H-,22,25);1H.
What are the key properties of 4-(2,3-dimethylimidazol-3-ium-1-yl)-2,2-diphenylbutanamide iodide?
4-(2,3-dimethylimidazol-3-ium-1-yl)-2,2-diphenylbutanamide iodide has a molecular weight of 461.35 g/mol, XLogP of -0.51, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dimethylimidazol-3-ium-1-yl)-2,2-diphenylbutanamide iodide is sourced from PubChem (CID 15516742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).