About 6-(3-benzyl-2-methylimidazol-3-ium-1-yl)-2,2-diphenylhexanamide bromide
6-(3-benzyl-2-methylimidazol-3-ium-1-yl)-2,2-diphenylhexanamide bromide (PubChem CID 15516746) has the molecular formula C29H32BrN3O
and a molecular weight of 518.50 g/mol. Its IUPAC name is 6-(3-benzyl-2-methylimidazol-3-ium-1-yl)-2,2-diphenylhexanamide bromide.
Molecular Properties
| Compound Name | 6-(3-benzyl-2-methylimidazol-3-ium-1-yl)-2,2-diphenylhexanamide bromide |
| PubChem CID | 15516746 |
| Molecular Formula | C29H32BrN3O |
| Molecular Weight | 518.50 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 6-(3-benzyl-2-methylimidazol-3-ium-1-yl)-2,2-diphenylhexanamide bromide |
| SMILES | Cc1n(CCCCC(C(N)=O)(c2ccccc2)c2ccccc2)cc[n+]1Cc1ccccc1.[Br-] |
| InChI | InChI=1S/C29H31N3O.BrH/c1-24-31(21-22-32(24)23-25-13-5-2-6-14-25)20-12-11-19-29(28(30)33,26-15-7-3-8-16-26)27-17-9-4-10-18-27;/h2-10,13-18,21-22H,11-12,19-20,23H2,1H3,(H-,30,33);1H |
| InChIKey | YCCGNTHDBNFYKH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 51.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 518.50 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-benzyl-2-methylimidazol-3-ium-1-yl)-2,2-diphenylhexanamide bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-benzyl-2-methylimidazol-3-ium-1-yl)-2,2-diphenylhexanamide bromide?
The IUPAC name of 6-(3-benzyl-2-methylimidazol-3-ium-1-yl)-2,2-diphenylhexanamide bromide (CID 15516746) is 6-(3-benzyl-2-methylimidazol-3-ium-1-yl)-2,2-diphenylhexanamide bromide.
What is the SMILES notation for 6-(3-benzyl-2-methylimidazol-3-ium-1-yl)-2,2-diphenylhexanamide bromide?
The canonical SMILES for 6-(3-benzyl-2-methylimidazol-3-ium-1-yl)-2,2-diphenylhexanamide bromide is Cc1n(CCCCC(C(N)=O)(c2ccccc2)c2ccccc2)cc[n+]1Cc1ccccc1.[Br-].
What is the InChIKey of 6-(3-benzyl-2-methylimidazol-3-ium-1-yl)-2,2-diphenylhexanamide bromide?
The InChIKey is YCCGNTHDBNFYKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H31N3O.BrH/c1-24-31(21-22-32(24)23-25-13-5-2-6-14-25)20-12-11-19-29(28(30)33,26-15-7-3-8-16-26)27-17-9-4-10-18-27;/h2-10,13-18,21-22H,11-12,19-20,23H2,1H3,(H-,30,33);1H.
What are the key properties of 6-(3-benzyl-2-methylimidazol-3-ium-1-yl)-2,2-diphenylhexanamide bromide?
6-(3-benzyl-2-methylimidazol-3-ium-1-yl)-2,2-diphenylhexanamide bromide has a molecular weight of 518.50 g/mol, XLogP of 1.78, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-benzyl-2-methylimidazol-3-ium-1-yl)-2,2-diphenylhexanamide bromide is sourced from PubChem (CID 15516746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).