About 1-[2-(1H-indazol-4-yl)-1,3-thiazol-5-yl]-1-(6-methylimidazo[1,2-a]pyridin-2-yl)ethanol
1-[2-(1H-indazol-4-yl)-1,3-thiazol-5-yl]-1-(6-methylimidazo[1,2-a]pyridin-2-yl)ethanol (PubChem CID 155167548) has the molecular formula C20H17N5OS
and a molecular weight of 375.46 g/mol. Its IUPAC name is 1-[2-(1H-indazol-4-yl)-1,3-thiazol-5-yl]-1-(6-methylimidazo[1,2-a]pyridin-2-yl)ethanol.
Molecular Properties
| Compound Name | 1-[2-(1H-indazol-4-yl)-1,3-thiazol-5-yl]-1-(6-methylimidazo[1,2-a]pyridin-2-yl)ethanol |
| PubChem CID | 155167548 |
| Molecular Formula | C20H17N5OS |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 1-[2-(1H-indazol-4-yl)-1,3-thiazol-5-yl]-1-(6-methylimidazo[1,2-a]pyridin-2-yl)ethanol |
| SMILES | Cc1ccc2nc(C(C)(O)c3cnc(-c4cccc5[nH]ncc45)s3)cn2c1 |
| InChI | InChI=1S/C20H17N5OS/c1-12-6-7-18-23-16(11-25(18)10-12)20(2,26)17-9-21-19(27-17)13-4-3-5-15-14(13)8-22-24-15/h3-11,26H,1-2H3,(H,22,24) |
| InChIKey | DGTCSKRKIPGVEE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2-(1H-indazol-4-yl)-1,3-thiazol-5-yl]-1-(6-methylimidazo[1,2-a]pyridin-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1H-indazol-4-yl)-1,3-thiazol-5-yl]-1-(6-methylimidazo[1,2-a]pyridin-2-yl)ethanol?
The IUPAC name of 1-[2-(1H-indazol-4-yl)-1,3-thiazol-5-yl]-1-(6-methylimidazo[1,2-a]pyridin-2-yl)ethanol (CID 155167548) is 1-[2-(1H-indazol-4-yl)-1,3-thiazol-5-yl]-1-(6-methylimidazo[1,2-a]pyridin-2-yl)ethanol.
What is the SMILES notation for 1-[2-(1H-indazol-4-yl)-1,3-thiazol-5-yl]-1-(6-methylimidazo[1,2-a]pyridin-2-yl)ethanol?
The canonical SMILES for 1-[2-(1H-indazol-4-yl)-1,3-thiazol-5-yl]-1-(6-methylimidazo[1,2-a]pyridin-2-yl)ethanol is Cc1ccc2nc(C(C)(O)c3cnc(-c4cccc5[nH]ncc45)s3)cn2c1.
What is the InChIKey of 1-[2-(1H-indazol-4-yl)-1,3-thiazol-5-yl]-1-(6-methylimidazo[1,2-a]pyridin-2-yl)ethanol?
The InChIKey is DGTCSKRKIPGVEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N5OS/c1-12-6-7-18-23-16(11-25(18)10-12)20(2,26)17-9-21-19(27-17)13-4-3-5-15-14(13)8-22-24-15/h3-11,26H,1-2H3,(H,22,24).
What are the key properties of 1-[2-(1H-indazol-4-yl)-1,3-thiazol-5-yl]-1-(6-methylimidazo[1,2-a]pyridin-2-yl)ethanol?
1-[2-(1H-indazol-4-yl)-1,3-thiazol-5-yl]-1-(6-methylimidazo[1,2-a]pyridin-2-yl)ethanol has a molecular weight of 375.46 g/mol, XLogP of 3.90, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1H-indazol-4-yl)-1,3-thiazol-5-yl]-1-(6-methylimidazo[1,2-a]pyridin-2-yl)ethanol is sourced from PubChem (CID 155167548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).