About lithium 4-oxopyrido[1,2-a]pyrimidine-2-carboxylate
lithium 4-oxopyrido[1,2-a]pyrimidine-2-carboxylate (PubChem CID 155167560) has the molecular formula C9H5LiN2O3
and a molecular weight of 196.09 g/mol. Its IUPAC name is lithium 4-oxopyrido[1,2-a]pyrimidine-2-carboxylate.
Molecular Properties
| Compound Name | lithium 4-oxopyrido[1,2-a]pyrimidine-2-carboxylate |
| PubChem CID | 155167560 |
| Molecular Formula | C9H5LiN2O3 |
| Molecular Weight | 196.09 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | lithium 4-oxopyrido[1,2-a]pyrimidine-2-carboxylate |
| SMILES | O=C([O-])c1cc(=O)n2ccccc2n1.[Li+] |
| InChI | InChI=1S/C9H6N2O3.Li/c12-8-5-6(9(13)14)10-7-3-1-2-4-11(7)8;/h1-5H,(H,13,14);/q;+1/p-1 |
| InChIKey | VXGGXFKYEVFDIK-UHFFFAOYSA-M |
| XLogP | -3.94 |
| TPSA | 74.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.09 |
| LogP ≤ 5 | -3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze lithium 4-oxopyrido[1,2-a]pyrimidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 4-oxopyrido[1,2-a]pyrimidine-2-carboxylate?
The IUPAC name of lithium 4-oxopyrido[1,2-a]pyrimidine-2-carboxylate (CID 155167560) is lithium 4-oxopyrido[1,2-a]pyrimidine-2-carboxylate.
What is the SMILES notation for lithium 4-oxopyrido[1,2-a]pyrimidine-2-carboxylate?
The canonical SMILES for lithium 4-oxopyrido[1,2-a]pyrimidine-2-carboxylate is O=C([O-])c1cc(=O)n2ccccc2n1.[Li+].
What is the InChIKey of lithium 4-oxopyrido[1,2-a]pyrimidine-2-carboxylate?
The InChIKey is VXGGXFKYEVFDIK-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H6N2O3.Li/c12-8-5-6(9(13)14)10-7-3-1-2-4-11(7)8;/h1-5H,(H,13,14);/q;+1/p-1.
What are the key properties of lithium 4-oxopyrido[1,2-a]pyrimidine-2-carboxylate?
lithium 4-oxopyrido[1,2-a]pyrimidine-2-carboxylate has a molecular weight of 196.09 g/mol, XLogP of -3.94, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 4-oxopyrido[1,2-a]pyrimidine-2-carboxylate is sourced from PubChem (CID 155167560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).