About 2-(butylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide
2-(butylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 155168008) has the molecular formula C12H19N3O4S
and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-(butylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide.
Molecular Properties
| Compound Name | 2-(butylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide |
| PubChem CID | 155168008 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-(butylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | CCCCNc1ccc([N+](=O)[O-])cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C12H19N3O4S/c1-4-5-8-13-11-7-6-10(15(16)17)9-12(11)20(18,19)14(2)3/h6-7,9,13H,4-5,8H2,1-3H3 |
| InChIKey | IHJCCCAGJWBNSA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(butylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide?
The IUPAC name of 2-(butylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide (CID 155168008) is 2-(butylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide.
What is the SMILES notation for 2-(butylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide?
The canonical SMILES for 2-(butylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide is CCCCNc1ccc([N+](=O)[O-])cc1S(=O)(=O)N(C)C.
What is the InChIKey of 2-(butylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide?
The InChIKey is IHJCCCAGJWBNSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O4S/c1-4-5-8-13-11-7-6-10(15(16)17)9-12(11)20(18,19)14(2)3/h6-7,9,13H,4-5,8H2,1-3H3.
What are the key properties of 2-(butylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide?
2-(butylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide has a molecular weight of 301.37 g/mol, XLogP of 2.06, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butylamino)-N,N-dimethyl-5-nitrobenzenesulfonamide is sourced from PubChem (CID 155168008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).