About 6-ethyl-2,3-dimethyl-2,4-dihydro-1H-pyrimidine
6-ethyl-2,3-dimethyl-2,4-dihydro-1H-pyrimidine (PubChem CID 155168116) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 6-ethyl-2,3-dimethyl-2,4-dihydro-1H-pyrimidine.
Molecular Properties
| Compound Name | 6-ethyl-2,3-dimethyl-2,4-dihydro-1H-pyrimidine |
| PubChem CID | 155168116 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 6-ethyl-2,3-dimethyl-2,4-dihydro-1H-pyrimidine |
| SMILES | CCC1=CCN(C)C(C)N1 |
| InChI | InChI=1S/C8H16N2/c1-4-8-5-6-10(3)7(2)9-8/h5,7,9H,4,6H2,1-3H3 |
| InChIKey | CPJICTNFJOANAO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethyl-2,3-dimethyl-2,4-dihydro-1H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2,3-dimethyl-2,4-dihydro-1H-pyrimidine?
The IUPAC name of 6-ethyl-2,3-dimethyl-2,4-dihydro-1H-pyrimidine (CID 155168116) is 6-ethyl-2,3-dimethyl-2,4-dihydro-1H-pyrimidine.
What is the SMILES notation for 6-ethyl-2,3-dimethyl-2,4-dihydro-1H-pyrimidine?
The canonical SMILES for 6-ethyl-2,3-dimethyl-2,4-dihydro-1H-pyrimidine is CCC1=CCN(C)C(C)N1.
What is the InChIKey of 6-ethyl-2,3-dimethyl-2,4-dihydro-1H-pyrimidine?
The InChIKey is CPJICTNFJOANAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-4-8-5-6-10(3)7(2)9-8/h5,7,9H,4,6H2,1-3H3.
What are the key properties of 6-ethyl-2,3-dimethyl-2,4-dihydro-1H-pyrimidine?
6-ethyl-2,3-dimethyl-2,4-dihydro-1H-pyrimidine has a molecular weight of 140.23 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2,3-dimethyl-2,4-dihydro-1H-pyrimidine is sourced from PubChem (CID 155168116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).