C27H18F6O4 — CID 155168272
4-[[6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]oxymethyl]benzoic acid (PubChem CID 155168272) has the molecular formula C27H18F6O4 and a molecular weight of 520.43 g/mol. Its IUPAC name is 4-[[6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]oxymethyl]benzoic acid.
| Compound Name | 4-[[6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 155168272 |
| Molecular Formula | C27H18F6O4 |
| Molecular Weight | 520.43 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 4-[[6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]oxymethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2ccc3c(c2)CCC(=Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C3=O)cc1 |
| InChI | InChI=1S/C27H18F6O4/c28-26(29,30)20-10-16(11-21(13-20)27(31,32)33)9-19-6-5-18-12-22(7-8-23(18)24(19)34)37-14-15-1-3-17(4-2-15)25(35)36/h1-4,7-13H,5-6,14H2,(H,35,36) |
| InChIKey | AFCTYSDTMRPDMG-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.43 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|