C25H27FN2O4 — CID 155168417
6-[3-[1-[(4-fluorobenzoyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoylamino]hexanoic acid (PubChem CID 155168417) has the molecular formula C25H27FN2O4 and a molecular weight of 438.50 g/mol. Its IUPAC name is 6-[3-[1-[(4-fluorobenzoyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoylamino]hexanoic acid.
| Compound Name | 6-[3-[1-[(4-fluorobenzoyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoylamino]hexanoic acid |
|---|---|
| PubChem CID | 155168417 |
| Molecular Formula | C25H27FN2O4 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 6-[3-[1-[(4-fluorobenzoyl)amino]-2,3-dihydro-1H-inden-5-yl]prop-2-enoylamino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)C=Cc1ccc2c(c1)CCC2NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H27FN2O4/c26-20-10-7-18(8-11-20)25(32)28-22-13-9-19-16-17(5-12-21(19)22)6-14-23(29)27-15-3-1-2-4-24(30)31/h5-8,10-12,14,16,22H,1-4,9,13,15H2,(H,27,29)(H,28,32)(H,30,31) |
| InChIKey | BJGLVHXBNWRUQD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|