C32H28F7N3O3 — CID 155168678
(6E)-N-[6-(2-amino-4-fluoroanilino)-6-oxohexyl]-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalene-2-carboxamide (PubChem CID 155168678) has the molecular formula C32H28F7N3O3 and a molecular weight of 635.58 g/mol. Its IUPAC name is (6E)-N-[6-(2-amino-4-fluoroanilino)-6-oxohexyl]-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalene-2-carboxamide.
| Compound Name | (6E)-N-[6-(2-amino-4-fluoroanilino)-6-oxohexyl]-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 155168678 |
| Molecular Formula | C32H28F7N3O3 |
| Molecular Weight | 635.58 g/mol |
| Exact Mass | 635.20 |
| IUPAC Name | (6E)-N-[6-(2-amino-4-fluoroanilino)-6-oxohexyl]-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalene-2-carboxamide |
| SMILES | Nc1cc(F)ccc1NC(=O)CCCCCNC(=O)c1ccc2c(c1)CC/C(=C\c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2=O |
| InChI | InChI=1S/C32H28F7N3O3/c33-24-8-10-27(26(40)17-24)42-28(43)4-2-1-3-11-41-30(45)21-7-9-25-19(15-21)5-6-20(29(25)44)12-18-13-22(31(34,35)36)16-23(14-18)32(37,38)39/h7-10,12-17H,1-6,11,40H2,(H,41,45)(H,42,43)/b20-12+ |
| InChIKey | JKXLMTRMQUEHDR-UDWIEESQSA-N |
| XLogP | 7.59 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.58 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|