About (4S)-4-but-1-ynyl-5-fluoro-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one
(4S)-4-but-1-ynyl-5-fluoro-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (PubChem CID 15516907) has the molecular formula C13H9F4NO2
and a molecular weight of 287.21 g/mol. Its IUPAC name is (4S)-4-but-1-ynyl-5-fluoro-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one.
Molecular Properties
| Compound Name | (4S)-4-but-1-ynyl-5-fluoro-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| PubChem CID | 15516907 |
| Molecular Formula | C13H9F4NO2 |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | (4S)-4-but-1-ynyl-5-fluoro-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| SMILES | CCC#C[C@]1(C(F)(F)F)OC(=O)Nc2cccc(F)c21 |
| InChI | InChI=1S/C13H9F4NO2/c1-2-3-7-12(13(15,16)17)10-8(14)5-4-6-9(10)18-11(19)20-12/h4-6H,2H2,1H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | ONRIKESGIHQCDK-LBPRGKRZSA-N |
| XLogP | 3.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-but-1-ynyl-5-fluoro-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-but-1-ynyl-5-fluoro-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one?
The IUPAC name of (4S)-4-but-1-ynyl-5-fluoro-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (CID 15516907) is (4S)-4-but-1-ynyl-5-fluoro-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one.
What is the SMILES notation for (4S)-4-but-1-ynyl-5-fluoro-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one?
The canonical SMILES for (4S)-4-but-1-ynyl-5-fluoro-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one is CCC#C[C@]1(C(F)(F)F)OC(=O)Nc2cccc(F)c21.
What is the InChIKey of (4S)-4-but-1-ynyl-5-fluoro-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one?
The InChIKey is ONRIKESGIHQCDK-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H9F4NO2/c1-2-3-7-12(13(15,16)17)10-8(14)5-4-6-9(10)18-11(19)20-12/h4-6H,2H2,1H3,(H,18,19)/t12-/m0/s1.
What are the key properties of (4S)-4-but-1-ynyl-5-fluoro-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one?
(4S)-4-but-1-ynyl-5-fluoro-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one has a molecular weight of 287.21 g/mol, XLogP of 3.56, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-but-1-ynyl-5-fluoro-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one is sourced from PubChem (CID 15516907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).