C7H8N2O3 — CID 155169577
(6-oxo-1H-pyridin-3-yl)methylcarbamic acid (PubChem CID 155169577) has the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. Its IUPAC name is (6-oxo-1H-pyridin-3-yl)methylcarbamic acid.
| Compound Name | (6-oxo-1H-pyridin-3-yl)methylcarbamic acid |
|---|---|
| PubChem CID | 155169577 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | (6-oxo-1H-pyridin-3-yl)methylcarbamic acid |
| SMILES | O=C(O)NCc1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C7H8N2O3/c10-6-2-1-5(3-8-6)4-9-7(11)12/h1-3,9H,4H2,(H,8,10)(H,11,12) |
| InChIKey | XBJLUYZWAURTFQ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |