C27H31N5O6S — CID 155169660
3-[2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethyl]-7-pyridin-3-ylsulfonyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 155169660) has the molecular formula C27H31N5O6S and a molecular weight of 553.64 g/mol. Its IUPAC name is 3-[2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethyl]-7-pyridin-3-ylsulfonyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethyl]-7-pyridin-3-ylsulfonyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 155169660 |
| Molecular Formula | C27H31N5O6S |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | 3-[2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethyl]-7-pyridin-3-ylsulfonyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | CCN(CC)c1ccc2c(C)c(CCN3C(=O)NC4(CCN(S(=O)(=O)c5cccnc5)C4)C3=O)c(=O)oc2c1 |
| InChI | InChI=1S/C27H31N5O6S/c1-4-30(5-2)19-8-9-21-18(3)22(24(33)38-23(21)15-19)10-13-32-25(34)27(29-26(32)35)11-14-31(17-27)39(36,37)20-7-6-12-28-16-20/h6-9,12,15-16H,4-5,10-11,13-14,17H2,1-3H3,(H,29,35) |
| InChIKey | XMTDPPNVFQRQOF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|