About 3-[[4-[2,6-bis(trideuteriomethyl)phenyl]-6-chloropyrimidin-2-yl]sulfamoyl]benzoic acid
3-[[4-[2,6-bis(trideuteriomethyl)phenyl]-6-chloropyrimidin-2-yl]sulfamoyl]benzoic acid (PubChem CID 155169732) has the molecular formula C19H16ClN3O4S
and a molecular weight of 423.91 g/mol. Its IUPAC name is 3-[[4-[2,6-bis(trideuteriomethyl)phenyl]-6-chloropyrimidin-2-yl]sulfamoyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[[4-[2,6-bis(trideuteriomethyl)phenyl]-6-chloropyrimidin-2-yl]sulfamoyl]benzoic acid |
| PubChem CID | 155169732 |
| Molecular Formula | C19H16ClN3O4S |
| Molecular Weight | 423.91 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 3-[[4-[2,6-bis(trideuteriomethyl)phenyl]-6-chloropyrimidin-2-yl]sulfamoyl]benzoic acid |
| SMILES | [2H]C([2H])([2H])c1cccc(C([2H])([2H])[2H])c1-c1cc(Cl)nc(NS(=O)(=O)c2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C19H16ClN3O4S/c1-11-5-3-6-12(2)17(11)15-10-16(20)22-19(21-15)23-28(26,27)14-8-4-7-13(9-14)18(24)25/h3-10H,1-2H3,(H,24,25)(H,21,22,23)/i1D3,2D3 |
| InChIKey | VZEOOSWDDBRJTF-WFGJKAKNSA-N |
| XLogP | 3.91 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.91 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[4-[2,6-bis(trideuteriomethyl)phenyl]-6-chloropyrimidin-2-yl]sulfamoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-[2,6-bis(trideuteriomethyl)phenyl]-6-chloropyrimidin-2-yl]sulfamoyl]benzoic acid?
The IUPAC name of 3-[[4-[2,6-bis(trideuteriomethyl)phenyl]-6-chloropyrimidin-2-yl]sulfamoyl]benzoic acid (CID 155169732) is 3-[[4-[2,6-bis(trideuteriomethyl)phenyl]-6-chloropyrimidin-2-yl]sulfamoyl]benzoic acid.
What is the SMILES notation for 3-[[4-[2,6-bis(trideuteriomethyl)phenyl]-6-chloropyrimidin-2-yl]sulfamoyl]benzoic acid?
The canonical SMILES for 3-[[4-[2,6-bis(trideuteriomethyl)phenyl]-6-chloropyrimidin-2-yl]sulfamoyl]benzoic acid is [2H]C([2H])([2H])c1cccc(C([2H])([2H])[2H])c1-c1cc(Cl)nc(NS(=O)(=O)c2cccc(C(=O)O)c2)n1.
What is the InChIKey of 3-[[4-[2,6-bis(trideuteriomethyl)phenyl]-6-chloropyrimidin-2-yl]sulfamoyl]benzoic acid?
The InChIKey is VZEOOSWDDBRJTF-WFGJKAKNSA-N. The full InChI is InChI=1S/C19H16ClN3O4S/c1-11-5-3-6-12(2)17(11)15-10-16(20)22-19(21-15)23-28(26,27)14-8-4-7-13(9-14)18(24)25/h3-10H,1-2H3,(H,24,25)(H,21,22,23)/i1D3,2D3.
What are the key properties of 3-[[4-[2,6-bis(trideuteriomethyl)phenyl]-6-chloropyrimidin-2-yl]sulfamoyl]benzoic acid?
3-[[4-[2,6-bis(trideuteriomethyl)phenyl]-6-chloropyrimidin-2-yl]sulfamoyl]benzoic acid has a molecular weight of 423.91 g/mol, XLogP of 3.91, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-[2,6-bis(trideuteriomethyl)phenyl]-6-chloropyrimidin-2-yl]sulfamoyl]benzoic acid is sourced from PubChem (CID 155169732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).