C31H38N4O5S — CID 155169743
3-[[4-(2,6-dimethylphenyl)-6-[(2R)-4-methyl-2-[(4,4,5,6,6-pentadeuteriospiro[2.3]hexan-5-yl)amino]pentoxy]pyrimidin-2-yl]sulfamoyl]benzoic acid (PubChem CID 155169743) has the molecular formula C31H38N4O5S and a molecular weight of 583.77 g/mol. Its IUPAC name is 3-[[4-(2,6-dimethylphenyl)-6-[(2R)-4-methyl-2-[(4,4,5,6,6-pentadeuteriospiro[2.3]hexan-5-yl)amino]pentoxy]pyrimidin-2-yl]sulfamoyl]benzoic acid.
| Compound Name | 3-[[4-(2,6-dimethylphenyl)-6-[(2R)-4-methyl-2-[(4,4,5,6,6-pentadeuteriospiro[2.3]hexan-5-yl)amino]pentoxy]pyrimidin-2-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 155169743 |
| Molecular Formula | C31H38N4O5S |
| Molecular Weight | 583.77 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | 3-[[4-(2,6-dimethylphenyl)-6-[(2R)-4-methyl-2-[(4,4,5,6,6-pentadeuteriospiro[2.3]hexan-5-yl)amino]pentoxy]pyrimidin-2-yl]sulfamoyl]benzoic acid |
| SMILES | [2H]C1([2H])C2(CC2)C([2H])([2H])C1([2H])N[C@@H](COc1cc(-c2c(C)cccc2C)nc(NS(=O)(=O)c2cccc(C(=O)O)c2)n1)CC(C)C |
| InChI | InChI=1S/C31H38N4O5S/c1-19(2)13-23(32-24-16-31(17-24)11-12-31)18-40-27-15-26(28-20(3)7-5-8-21(28)4)33-30(34-27)35-41(38,39)25-10-6-9-22(14-25)29(36)37/h5-10,14-15,19,23-24,32H,11-13,16-18H2,1-4H3,(H,36,37)(H,33,34,35)/t23-/m1/s1/i16D2,17D2,24D |
| InChIKey | QFXHUHGKRKZTEX-KWDKKKJBSA-N |
| XLogP | 5.59 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.77 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |