About (E)-N-(2,2,2-trifluoroethylsulfonyl)but-2-enamide
(E)-N-(2,2,2-trifluoroethylsulfonyl)but-2-enamide (PubChem CID 155170692) has the molecular formula C6H8F3NO3S
and a molecular weight of 231.19 g/mol. Its IUPAC name is (E)-N-(2,2,2-trifluoroethylsulfonyl)but-2-enamide.
Molecular Properties
| Compound Name | (E)-N-(2,2,2-trifluoroethylsulfonyl)but-2-enamide |
| PubChem CID | 155170692 |
| Molecular Formula | C6H8F3NO3S |
| Molecular Weight | 231.19 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | (E)-N-(2,2,2-trifluoroethylsulfonyl)but-2-enamide |
| SMILES | C/C=C/C(=O)NS(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C6H8F3NO3S/c1-2-3-5(11)10-14(12,13)4-6(7,8)9/h2-3H,4H2,1H3,(H,10,11)/b3-2+ |
| InChIKey | HMEPAPUVVNRRIZ-NSCUHMNNSA-N |
| XLogP | 0.57 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(2,2,2-trifluoroethylsulfonyl)but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(2,2,2-trifluoroethylsulfonyl)but-2-enamide?
The IUPAC name of (E)-N-(2,2,2-trifluoroethylsulfonyl)but-2-enamide (CID 155170692) is (E)-N-(2,2,2-trifluoroethylsulfonyl)but-2-enamide.
What is the SMILES notation for (E)-N-(2,2,2-trifluoroethylsulfonyl)but-2-enamide?
The canonical SMILES for (E)-N-(2,2,2-trifluoroethylsulfonyl)but-2-enamide is C/C=C/C(=O)NS(=O)(=O)CC(F)(F)F.
What is the InChIKey of (E)-N-(2,2,2-trifluoroethylsulfonyl)but-2-enamide?
The InChIKey is HMEPAPUVVNRRIZ-NSCUHMNNSA-N. The full InChI is InChI=1S/C6H8F3NO3S/c1-2-3-5(11)10-14(12,13)4-6(7,8)9/h2-3H,4H2,1H3,(H,10,11)/b3-2+.
What are the key properties of (E)-N-(2,2,2-trifluoroethylsulfonyl)but-2-enamide?
(E)-N-(2,2,2-trifluoroethylsulfonyl)but-2-enamide has a molecular weight of 231.19 g/mol, XLogP of 0.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(2,2,2-trifluoroethylsulfonyl)but-2-enamide is sourced from PubChem (CID 155170692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).