C18H20O6 — CID 155171240
2-[[(1S,5R,6S,8R)-9,10-dimethyl-2,7-dioxatricyclo[4.3.1.03,8]decan-5-yl]oxycarbonyl]benzoic acid (PubChem CID 155171240) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is 2-[[(1S,5R,6S,8R)-9,10-dimethyl-2,7-dioxatricyclo[4.3.1.03,8]decan-5-yl]oxycarbonyl]benzoic acid.
| Compound Name | 2-[[(1S,5R,6S,8R)-9,10-dimethyl-2,7-dioxatricyclo[4.3.1.03,8]decan-5-yl]oxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 155171240 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-[[(1S,5R,6S,8R)-9,10-dimethyl-2,7-dioxatricyclo[4.3.1.03,8]decan-5-yl]oxycarbonyl]benzoic acid |
| SMILES | CC1[C@H]2O[C@H]3C(C)[C@H]1OC2C[C@H]3OC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C18H20O6/c1-8-14-9(2)16-13(7-12(22-14)15(8)24-16)23-18(21)11-6-4-3-5-10(11)17(19)20/h3-6,8-9,12-16H,7H2,1-2H3,(H,19,20)/t8?,9?,12?,13-,14+,15-,16+/m1/s1 |
| InChIKey | MJXBVQLLKFAYBZ-CCVXHPJHSA-N |
| XLogP | 2.12 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |