C15H23NO4 — CID 155171278
N-[(2R,3R)-3-[[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-2-methyl-4-oxooxetan-3-yl]butanamide (PubChem CID 155171278) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is N-[(2R,3R)-3-[[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-2-methyl-4-oxooxetan-3-yl]butanamide.
| Compound Name | N-[(2R,3R)-3-[[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-2-methyl-4-oxooxetan-3-yl]butanamide |
|---|---|
| PubChem CID | 155171278 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-[(2R,3R)-3-[[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-2-methyl-4-oxooxetan-3-yl]butanamide |
| SMILES | CCCC(=O)N[C@@]1(C(O)[C@@H]2C=CCCC2)C(=O)O[C@@H]1C |
| InChI | InChI=1S/C15H23NO4/c1-3-7-12(17)16-15(10(2)20-14(15)19)13(18)11-8-5-4-6-9-11/h5,8,10-11,13,18H,3-4,6-7,9H2,1-2H3,(H,16,17)/t10-,11-,13?,15+/m1/s1 |
| InChIKey | RZKLUBJZUZYVSZ-WTOQSZCESA-N |
| XLogP | 1.30 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|