C13H4F15N3 — CID 15517144
4-fluoro-2,4-bis(1,1,2,2,3,3,3-heptafluoropropyl)pyrido[1,2-a][1,3,5]triazine (PubChem CID 15517144) has the molecular formula C13H4F15N3 and a molecular weight of 487.17 g/mol. Its IUPAC name is 4-fluoro-2,4-bis(1,1,2,2,3,3,3-heptafluoropropyl)pyrido[1,2-a][1,3,5]triazine.
| Compound Name | 4-fluoro-2,4-bis(1,1,2,2,3,3,3-heptafluoropropyl)pyrido[1,2-a][1,3,5]triazine |
|---|---|
| PubChem CID | 15517144 |
| Molecular Formula | C13H4F15N3 |
| Molecular Weight | 487.17 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | 4-fluoro-2,4-bis(1,1,2,2,3,3,3-heptafluoropropyl)pyrido[1,2-a][1,3,5]triazine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C1=NC(F)(C(F)(F)C(F)(F)C(F)(F)F)N2C=CC=CC2=N1 |
| InChI | InChI=1S/C13H4F15N3/c14-7(15,8(16,17)11(22,23)24)6-29-5-3-1-2-4-31(5)13(28,30-6)10(20,21)9(18,19)12(25,26)27/h1-4H |
| InChIKey | JLZBKKHLSFTOGW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.17 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|