About 2-[5-(2,3-dihydro-1-benzofuran-5-yl)-6-(propylsulfamoylamino)pyrimidin-4-yl]oxyethanol
2-[5-(2,3-dihydro-1-benzofuran-5-yl)-6-(propylsulfamoylamino)pyrimidin-4-yl]oxyethanol (PubChem CID 155171972) has the molecular formula C17H22N4O5S
and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-[5-(2,3-dihydro-1-benzofuran-5-yl)-6-(propylsulfamoylamino)pyrimidin-4-yl]oxyethanol.
Molecular Properties
| Compound Name | 2-[5-(2,3-dihydro-1-benzofuran-5-yl)-6-(propylsulfamoylamino)pyrimidin-4-yl]oxyethanol |
| PubChem CID | 155171972 |
| Molecular Formula | C17H22N4O5S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-[5-(2,3-dihydro-1-benzofuran-5-yl)-6-(propylsulfamoylamino)pyrimidin-4-yl]oxyethanol |
| SMILES | CCCNS(=O)(=O)Nc1ncnc(OCCO)c1-c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C17H22N4O5S/c1-2-6-20-27(23,24)21-16-15(17(19-11-18-16)26-9-7-22)13-3-4-14-12(10-13)5-8-25-14/h3-4,10-11,20,22H,2,5-9H2,1H3,(H,18,19,21) |
| InChIKey | GJNOCHQAJWWKQT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 122.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[5-(2,3-dihydro-1-benzofuran-5-yl)-6-(propylsulfamoylamino)pyrimidin-4-yl]oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2,3-dihydro-1-benzofuran-5-yl)-6-(propylsulfamoylamino)pyrimidin-4-yl]oxyethanol?
The IUPAC name of 2-[5-(2,3-dihydro-1-benzofuran-5-yl)-6-(propylsulfamoylamino)pyrimidin-4-yl]oxyethanol (CID 155171972) is 2-[5-(2,3-dihydro-1-benzofuran-5-yl)-6-(propylsulfamoylamino)pyrimidin-4-yl]oxyethanol.
What is the SMILES notation for 2-[5-(2,3-dihydro-1-benzofuran-5-yl)-6-(propylsulfamoylamino)pyrimidin-4-yl]oxyethanol?
The canonical SMILES for 2-[5-(2,3-dihydro-1-benzofuran-5-yl)-6-(propylsulfamoylamino)pyrimidin-4-yl]oxyethanol is CCCNS(=O)(=O)Nc1ncnc(OCCO)c1-c1ccc2c(c1)CCO2.
What is the InChIKey of 2-[5-(2,3-dihydro-1-benzofuran-5-yl)-6-(propylsulfamoylamino)pyrimidin-4-yl]oxyethanol?
The InChIKey is GJNOCHQAJWWKQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O5S/c1-2-6-20-27(23,24)21-16-15(17(19-11-18-16)26-9-7-22)13-3-4-14-12(10-13)5-8-25-14/h3-4,10-11,20,22H,2,5-9H2,1H3,(H,18,19,21).
What are the key properties of 2-[5-(2,3-dihydro-1-benzofuran-5-yl)-6-(propylsulfamoylamino)pyrimidin-4-yl]oxyethanol?
2-[5-(2,3-dihydro-1-benzofuran-5-yl)-6-(propylsulfamoylamino)pyrimidin-4-yl]oxyethanol has a molecular weight of 394.45 g/mol, XLogP of 1.11, 9 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2,3-dihydro-1-benzofuran-5-yl)-6-(propylsulfamoylamino)pyrimidin-4-yl]oxyethanol is sourced from PubChem (CID 155171972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).