About (4E)-2-(4-tert-butylphenyl)-4-(quinolin-4-ylmethylidene)-1,3-oxazol-5-one
(4E)-2-(4-tert-butylphenyl)-4-(quinolin-4-ylmethylidene)-1,3-oxazol-5-one (PubChem CID 155172246) has the molecular formula C23H20N2O2
and a molecular weight of 356.43 g/mol. Its IUPAC name is (4E)-2-(4-tert-butylphenyl)-4-(quinolin-4-ylmethylidene)-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | (4E)-2-(4-tert-butylphenyl)-4-(quinolin-4-ylmethylidene)-1,3-oxazol-5-one |
| PubChem CID | 155172246 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (4E)-2-(4-tert-butylphenyl)-4-(quinolin-4-ylmethylidene)-1,3-oxazol-5-one |
| SMILES | CC(C)(C)c1ccc(C2=N/C(=C/c3ccnc4ccccc34)C(=O)O2)cc1 |
| InChI | InChI=1S/C23H20N2O2/c1-23(2,3)17-10-8-15(9-11-17)21-25-20(22(26)27-21)14-16-12-13-24-19-7-5-4-6-18(16)19/h4-14H,1-3H3/b20-14+ |
| InChIKey | VYEYWCXVJWYJKO-XSFVSMFZSA-N |
| XLogP | 4.88 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4E)-2-(4-tert-butylphenyl)-4-(quinolin-4-ylmethylidene)-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-2-(4-tert-butylphenyl)-4-(quinolin-4-ylmethylidene)-1,3-oxazol-5-one?
The IUPAC name of (4E)-2-(4-tert-butylphenyl)-4-(quinolin-4-ylmethylidene)-1,3-oxazol-5-one (CID 155172246) is (4E)-2-(4-tert-butylphenyl)-4-(quinolin-4-ylmethylidene)-1,3-oxazol-5-one.
What is the SMILES notation for (4E)-2-(4-tert-butylphenyl)-4-(quinolin-4-ylmethylidene)-1,3-oxazol-5-one?
The canonical SMILES for (4E)-2-(4-tert-butylphenyl)-4-(quinolin-4-ylmethylidene)-1,3-oxazol-5-one is CC(C)(C)c1ccc(C2=N/C(=C/c3ccnc4ccccc34)C(=O)O2)cc1.
What is the InChIKey of (4E)-2-(4-tert-butylphenyl)-4-(quinolin-4-ylmethylidene)-1,3-oxazol-5-one?
The InChIKey is VYEYWCXVJWYJKO-XSFVSMFZSA-N. The full InChI is InChI=1S/C23H20N2O2/c1-23(2,3)17-10-8-15(9-11-17)21-25-20(22(26)27-21)14-16-12-13-24-19-7-5-4-6-18(16)19/h4-14H,1-3H3/b20-14+.
What are the key properties of (4E)-2-(4-tert-butylphenyl)-4-(quinolin-4-ylmethylidene)-1,3-oxazol-5-one?
(4E)-2-(4-tert-butylphenyl)-4-(quinolin-4-ylmethylidene)-1,3-oxazol-5-one has a molecular weight of 356.43 g/mol, XLogP of 4.88, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-2-(4-tert-butylphenyl)-4-(quinolin-4-ylmethylidene)-1,3-oxazol-5-one is sourced from PubChem (CID 155172246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).