C31H31ClFN3O4 — CID 155173269
(3-fluorophenyl) 6-chloro-1-[4-(3-morpholin-4-ylpropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 155173269) has the molecular formula C31H31ClFN3O4 and a molecular weight of 564.06 g/mol. Its IUPAC name is (3-fluorophenyl) 6-chloro-1-[4-(3-morpholin-4-ylpropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (3-fluorophenyl) 6-chloro-1-[4-(3-morpholin-4-ylpropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 155173269 |
| Molecular Formula | C31H31ClFN3O4 |
| Molecular Weight | 564.06 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | (3-fluorophenyl) 6-chloro-1-[4-(3-morpholin-4-ylpropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | O=C(Oc1cccc(F)c1)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1ccc(OCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C31H31ClFN3O4/c32-22-7-10-28-27(19-22)26-11-13-36(31(37)40-25-4-1-3-23(33)20-25)30(29(26)34-28)21-5-8-24(9-6-21)39-16-2-12-35-14-17-38-18-15-35/h1,3-10,19-20,30,34H,2,11-18H2 |
| InChIKey | NCVMSDGXAVSIBE-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 67.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.06 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|