C18H6F6N4OS — CID 155173308
2-sulfanylidene-6,7-bis(3,4,5-trifluorophenyl)-1H-pteridin-4-one (PubChem CID 155173308) has the molecular formula C18H6F6N4OS and a molecular weight of 440.33 g/mol. Its IUPAC name is 2-sulfanylidene-6,7-bis(3,4,5-trifluorophenyl)-1H-pteridin-4-one.
| Compound Name | 2-sulfanylidene-6,7-bis(3,4,5-trifluorophenyl)-1H-pteridin-4-one |
|---|---|
| PubChem CID | 155173308 |
| Molecular Formula | C18H6F6N4OS |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | 2-sulfanylidene-6,7-bis(3,4,5-trifluorophenyl)-1H-pteridin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2nc(-c3cc(F)c(F)c(F)c3)c(-c3cc(F)c(F)c(F)c3)nc12 |
| InChI | InChI=1S/C18H6F6N4OS/c19-7-1-5(2-8(20)11(7)23)13-14(6-3-9(21)12(24)10(22)4-6)26-16-15(25-13)17(29)28-18(30)27-16/h1-4H,(H2,26,27,28,29,30) |
| InChIKey | JPDWBSOVVWKGKS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|