About (7R)-5-tert-butyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine
(7R)-5-tert-butyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine (PubChem CID 155174510) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is (7R)-5-tert-butyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine.
Molecular Properties
| Compound Name | (7R)-5-tert-butyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine |
| PubChem CID | 155174510 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (7R)-5-tert-butyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine |
| SMILES | CN(C)[C@H]1CN(C(C)(C)C)CC12CC2 |
| InChI | InChI=1S/C12H24N2/c1-11(2,3)14-8-10(13(4)5)12(9-14)6-7-12/h10H,6-9H2,1-5H3/t10-/m0/s1 |
| InChIKey | XYUFYPCFYPPNTJ-JTQLQIEISA-N |
| XLogP | 1.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7R)-5-tert-butyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-5-tert-butyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine?
The IUPAC name of (7R)-5-tert-butyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine (CID 155174510) is (7R)-5-tert-butyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine.
What is the SMILES notation for (7R)-5-tert-butyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine?
The canonical SMILES for (7R)-5-tert-butyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine is CN(C)[C@H]1CN(C(C)(C)C)CC12CC2.
What is the InChIKey of (7R)-5-tert-butyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine?
The InChIKey is XYUFYPCFYPPNTJ-JTQLQIEISA-N. The full InChI is InChI=1S/C12H24N2/c1-11(2,3)14-8-10(13(4)5)12(9-14)6-7-12/h10H,6-9H2,1-5H3/t10-/m0/s1.
What are the key properties of (7R)-5-tert-butyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine?
(7R)-5-tert-butyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine has a molecular weight of 196.34 g/mol, XLogP of 1.81, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-5-tert-butyl-N,N-dimethyl-5-azaspiro[2.4]heptan-7-amine is sourced from PubChem (CID 155174510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).