About 1-fluoro-2,4,5-trimethyl-3-[(E)-prop-1-enyl]benzene
1-fluoro-2,4,5-trimethyl-3-[(E)-prop-1-enyl]benzene (PubChem CID 155174997) has the molecular formula C12H15F
and a molecular weight of 178.25 g/mol. Its IUPAC name is 1-fluoro-2,4,5-trimethyl-3-[(E)-prop-1-enyl]benzene.
Molecular Properties
| Compound Name | 1-fluoro-2,4,5-trimethyl-3-[(E)-prop-1-enyl]benzene |
| PubChem CID | 155174997 |
| Molecular Formula | C12H15F |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 1-fluoro-2,4,5-trimethyl-3-[(E)-prop-1-enyl]benzene |
| SMILES | C/C=C/c1c(C)c(C)cc(F)c1C |
| InChI | InChI=1S/C12H15F/c1-5-6-11-9(3)8(2)7-12(13)10(11)4/h5-7H,1-4H3/b6-5+ |
| InChIKey | WSTBXZAOFLXMPG-AATRIKPKSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-fluoro-2,4,5-trimethyl-3-[(E)-prop-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2,4,5-trimethyl-3-[(E)-prop-1-enyl]benzene?
The IUPAC name of 1-fluoro-2,4,5-trimethyl-3-[(E)-prop-1-enyl]benzene (CID 155174997) is 1-fluoro-2,4,5-trimethyl-3-[(E)-prop-1-enyl]benzene.
What is the SMILES notation for 1-fluoro-2,4,5-trimethyl-3-[(E)-prop-1-enyl]benzene?
The canonical SMILES for 1-fluoro-2,4,5-trimethyl-3-[(E)-prop-1-enyl]benzene is C/C=C/c1c(C)c(C)cc(F)c1C.
What is the InChIKey of 1-fluoro-2,4,5-trimethyl-3-[(E)-prop-1-enyl]benzene?
The InChIKey is WSTBXZAOFLXMPG-AATRIKPKSA-N. The full InChI is InChI=1S/C12H15F/c1-5-6-11-9(3)8(2)7-12(13)10(11)4/h5-7H,1-4H3/b6-5+.
What are the key properties of 1-fluoro-2,4,5-trimethyl-3-[(E)-prop-1-enyl]benzene?
1-fluoro-2,4,5-trimethyl-3-[(E)-prop-1-enyl]benzene has a molecular weight of 178.25 g/mol, XLogP of 3.78, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2,4,5-trimethyl-3-[(E)-prop-1-enyl]benzene is sourced from PubChem (CID 155174997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).