C10H11F3N4O — CID 155175283
N-methoxy-7-(1,1,1-trifluoropropan-2-yl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 155175283) has the molecular formula C10H11F3N4O and a molecular weight of 260.22 g/mol. Its IUPAC name is N-methoxy-7-(1,1,1-trifluoropropan-2-yl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-methoxy-7-(1,1,1-trifluoropropan-2-yl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155175283 |
| Molecular Formula | C10H11F3N4O |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | N-methoxy-7-(1,1,1-trifluoropropan-2-yl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CONc1ncnc2c1ccn2C(C)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N4O/c1-6(10(11,12)13)17-4-3-7-8(16-18-2)14-5-15-9(7)17/h3-6H,1-2H3,(H,14,15,16) |
| InChIKey | YAPXRWILAVTGCF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|