C21H20FN7O3 — CID 155175347
5-[[3-fluoro-5-(methyliminomethyl)phenyl]methyl]-N-[(3S)-5-methyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 155175347) has the molecular formula C21H20FN7O3 and a molecular weight of 437.44 g/mol. Its IUPAC name is 5-[[3-fluoro-5-(methyliminomethyl)phenyl]methyl]-N-[(3S)-5-methyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-[[3-fluoro-5-(methyliminomethyl)phenyl]methyl]-N-[(3S)-5-methyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 155175347 |
| Molecular Formula | C21H20FN7O3 |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 5-[[3-fluoro-5-(methyliminomethyl)phenyl]methyl]-N-[(3S)-5-methyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | C/N=C/c1cc(F)cc(Cc2nc(C(=O)N[C@H]3COc4cccnc4N(C)C3=O)n[nH]2)c1 |
| InChI | InChI=1S/C21H20FN7O3/c1-23-10-13-6-12(7-14(22)8-13)9-17-26-18(28-27-17)20(30)25-15-11-32-16-4-3-5-24-19(16)29(2)21(15)31/h3-8,10,15H,9,11H2,1-2H3,(H,25,30)(H,26,27,28)/b23-10+/t15-/m0/s1 |
| InChIKey | OUNJCXNPHKQTJX-MQEPLNOPSA-N |
| XLogP | 1.13 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|