C12H13ClN2O — CID 155175469
2-[(6-chloro-2-methylquinolin-4-yl)amino]ethanol (PubChem CID 155175469) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is 2-[(6-chloro-2-methylquinolin-4-yl)amino]ethanol.
| Compound Name | 2-[(6-chloro-2-methylquinolin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 155175469 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-[(6-chloro-2-methylquinolin-4-yl)amino]ethanol |
| SMILES | Cc1cc(NCCO)c2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C12H13ClN2O/c1-8-6-12(14-4-5-16)10-7-9(13)2-3-11(10)15-8/h2-3,6-7,16H,4-5H2,1H3,(H,14,15) |
| InChIKey | WYOARDJIOXKVNF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |