C25H37NO — CID 155175620
(6E)-5,5-dimethyl-6-[(2Z)-1-(methylamino)penta-2,4-dien-2-yl]tetracyclo[8.7.0.01,13.02,10]heptadeca-6,12-dien-15-ol (PubChem CID 155175620) has the molecular formula C25H37NO and a molecular weight of 367.58 g/mol. Its IUPAC name is (6E)-5,5-dimethyl-6-[(2Z)-1-(methylamino)penta-2,4-dien-2-yl]tetracyclo[8.7.0.01,13.02,10]heptadeca-6,12-dien-15-ol.
| Compound Name | (6E)-5,5-dimethyl-6-[(2Z)-1-(methylamino)penta-2,4-dien-2-yl]tetracyclo[8.7.0.01,13.02,10]heptadeca-6,12-dien-15-ol |
|---|---|
| PubChem CID | 155175620 |
| Molecular Formula | C25H37NO |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.29 |
| IUPAC Name | (6E)-5,5-dimethyl-6-[(2Z)-1-(methylamino)penta-2,4-dien-2-yl]tetracyclo[8.7.0.01,13.02,10]heptadeca-6,12-dien-15-ol |
| SMILES | C=C/C=C(CNC)/C1=C/CCC23CC=C4CC(O)CCC42C3CCC1(C)C |
| InChI | InChI=1S/C25H37NO/c1-5-7-18(17-26-4)21-8-6-12-24-14-9-19-16-20(27)10-15-25(19,24)22(24)11-13-23(21,2)3/h5,7-9,20,22,26-27H,1,6,10-17H2,2-4H3/b18-7+,21-8- |
| InChIKey | QQHGCDSUXFKJGT-PGINJLRJSA-N |
| XLogP | 5.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|