C17H21ClN4O2 — CID 155176208
7-[(3aS,6R,6aR)-6-ethenyl-2,2,6-trimethyl-5,6a-dihydro-4H-cyclopenta[d][1,3]dioxol-3a-yl]-2-chloropyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 155176208) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is 7-[(3aS,6R,6aR)-6-ethenyl-2,2,6-trimethyl-5,6a-dihydro-4H-cyclopenta[d][1,3]dioxol-3a-yl]-2-chloropyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[(3aS,6R,6aR)-6-ethenyl-2,2,6-trimethyl-5,6a-dihydro-4H-cyclopenta[d][1,3]dioxol-3a-yl]-2-chloropyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155176208 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 7-[(3aS,6R,6aR)-6-ethenyl-2,2,6-trimethyl-5,6a-dihydro-4H-cyclopenta[d][1,3]dioxol-3a-yl]-2-chloropyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C=C[C@@]1(C)CC[C@]2(n3ccc4c(N)nc(Cl)nc43)OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C17H21ClN4O2/c1-5-16(4)7-8-17(13(16)23-15(2,3)24-17)22-9-6-10-11(19)20-14(18)21-12(10)22/h5-6,9,13H,1,7-8H2,2-4H3,(H2,19,20,21)/t13-,16+,17+/m1/s1 |
| InChIKey | LMZBSQSXXPVOCU-COXVUDFISA-N |
| XLogP | 3.46 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|