About (2Z,4Z)-N-tert-butyl-2-(methylideneamino)hexa-2,4-dienamide
(2Z,4Z)-N-tert-butyl-2-(methylideneamino)hexa-2,4-dienamide (PubChem CID 155176584) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is (2Z,4Z)-N-tert-butyl-2-(methylideneamino)hexa-2,4-dienamide.
Molecular Properties
| Compound Name | (2Z,4Z)-N-tert-butyl-2-(methylideneamino)hexa-2,4-dienamide |
| PubChem CID | 155176584 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (2Z,4Z)-N-tert-butyl-2-(methylideneamino)hexa-2,4-dienamide |
| SMILES | C=N/C(=C\C=C/C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H18N2O/c1-6-7-8-9(12-5)10(14)13-11(2,3)4/h6-8H,5H2,1-4H3,(H,13,14)/b7-6-,9-8- |
| InChIKey | LTYDKZPXXRZWOS-JPDBVBESSA-N |
| XLogP | 2.06 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-N-tert-butyl-2-(methylideneamino)hexa-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-N-tert-butyl-2-(methylideneamino)hexa-2,4-dienamide?
The IUPAC name of (2Z,4Z)-N-tert-butyl-2-(methylideneamino)hexa-2,4-dienamide (CID 155176584) is (2Z,4Z)-N-tert-butyl-2-(methylideneamino)hexa-2,4-dienamide.
What is the SMILES notation for (2Z,4Z)-N-tert-butyl-2-(methylideneamino)hexa-2,4-dienamide?
The canonical SMILES for (2Z,4Z)-N-tert-butyl-2-(methylideneamino)hexa-2,4-dienamide is C=N/C(=C\C=C/C)C(=O)NC(C)(C)C.
What is the InChIKey of (2Z,4Z)-N-tert-butyl-2-(methylideneamino)hexa-2,4-dienamide?
The InChIKey is LTYDKZPXXRZWOS-JPDBVBESSA-N. The full InChI is InChI=1S/C11H18N2O/c1-6-7-8-9(12-5)10(14)13-11(2,3)4/h6-8H,5H2,1-4H3,(H,13,14)/b7-6-,9-8-.
What are the key properties of (2Z,4Z)-N-tert-butyl-2-(methylideneamino)hexa-2,4-dienamide?
(2Z,4Z)-N-tert-butyl-2-(methylideneamino)hexa-2,4-dienamide has a molecular weight of 194.28 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-N-tert-butyl-2-(methylideneamino)hexa-2,4-dienamide is sourced from PubChem (CID 155176584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).