C12H12F2OS — CID 155176690
2-[(3E,5E)-5-(difluoromethoxy)hepta-1,3,5-trien-3-yl]thiophene (PubChem CID 155176690) has the molecular formula C12H12F2OS and a molecular weight of 242.29 g/mol. Its IUPAC name is 2-[(3E,5E)-5-(difluoromethoxy)hepta-1,3,5-trien-3-yl]thiophene.
| Compound Name | 2-[(3E,5E)-5-(difluoromethoxy)hepta-1,3,5-trien-3-yl]thiophene |
|---|---|
| PubChem CID | 155176690 |
| Molecular Formula | C12H12F2OS |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-[(3E,5E)-5-(difluoromethoxy)hepta-1,3,5-trien-3-yl]thiophene |
| SMILES | C=C/C(=C\C(=C/C)OC(F)F)c1cccs1 |
| InChI | InChI=1S/C12H12F2OS/c1-3-9(11-6-5-7-16-11)8-10(4-2)15-12(13)14/h3-8,12H,1H2,2H3/b9-8+,10-4+ |
| InChIKey | XHSGHMVUAKTTCI-FJEDVWLASA-N |
| XLogP | 4.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|